CAS 1256358-57-2

B-[4-(4-Chloro-2-fluorophenoxy)phenyl]boronic acid

Description:

B-[4-(4-Chloro-2-fluorophenoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a 4-chloro-2-fluorophenoxy group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of chlorine and fluorine substituents on the aromatic ring can influence its reactivity, solubility, and biological activity. Boronic acids are known for their role in Suzuki coupling reactions, which are essential for forming carbon-carbon bonds in the synthesis of complex organic molecules. Additionally, the specific substitution pattern can affect the compound's electronic properties and potential interactions with biological targets. Overall, B-[4-(4-Chloro-2-fluorophenoxy)phenyl]boronic acid is a versatile compound with significant implications in both synthetic and pharmaceutical chemistry.

Formula: C₁₂H₉BClFO₃

InChI: InChI=1S/C12H9BClFO3/c14-9-3-6-12(11(15)7-9)18-10-4-1-8(2-5-10)13(16)17/h1-7,16-17H

InChI key: InChIKey=UQQJHJBZZCELBT-UHFFFAOYSA-N

SMILES: O(C1=C(F)C=C(Cl)C=C1)C2=CC=C(B(O)O)C=C2

Synonyms:

• Boronic acid, B-[4-(4-chloro-2-fluorophenoxy)phenyl]-
• B-[4-(4-Chloro-2-fluorophenoxy)phenyl]boronic acid

4-(4-Chloro-2-fluorophenoxy)phenylboronic acid

CAS: 1256358-57-2

Formula: C₁₂H₉BClFO₃

Molecular weight: 266.4605

Ref: IN-DA000O5P

4-(4-Chloro-2-fluorophenoxy)phenylboronic acid

CAS: 1256358-57-2

4-(4-Chloro-2-fluorophenoxy)phenylboronic acid

Purity: ≥95%

Molecular weight: 266.46g/mol

Ref: 54-PC412200