CAS 1256358-68-5

B-[2-[(2-Chlorophenoxy)methyl]phenyl]boronic acid

Description:

B-[2-[(2-Chlorophenoxy)methyl]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a chlorophenoxy group, which enhances its reactivity and solubility in organic solvents. The boronic acid moiety contributes to its potential as a ligand in transition metal-catalyzed reactions and as a building block in the synthesis of complex organic molecules. Additionally, the presence of the chlorine atom may influence the electronic properties and reactivity of the compound, potentially affecting its biological activity. Overall, this compound is of interest in the fields of pharmaceuticals and materials science due to its unique structural features and functional properties.

Formula: C₁₃H₁₂BClO₃

InChI: InChI=1S/C13H12BClO3/c15-12-7-3-4-8-13(12)18-9-10-5-1-2-6-11(10)14(16)17/h1-8,16-17H,9H2

InChI key: InChIKey=ONODGDHQBJDGHW-UHFFFAOYSA-N

SMILES: C(OC1=C(Cl)C=CC=C1)C2=C(B(O)O)C=CC=C2

Synonyms:

• Boronic acid, B-[2-[(2-chlorophenoxy)methyl]phenyl]-
• B-[2-[(2-Chlorophenoxy)methyl]phenyl]boronic acid
• (2-((2-Chlorophenoxy)Methyl)phenyl)boronic acid

2-(2-Chlorophenoxymethyl)phenylboronic acid

CAS: 1256358-68-5

Formula: C₁₃H₁₂BClO₃

Molecular weight: 262.4966

Ref: IN-DA000O5G