CymitQuimica logo

CAS 1256358-71-0

:

B-[2-[(4-Chlorophenoxy)methyl]phenyl]boronic acid

Description:
B-[2-[(4-Chlorophenoxy)methyl]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a phenyl ring substituted with a 4-chlorophenoxy group, enhancing its lipophilicity and potential biological activity. The boronic acid moiety allows for participation in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. Its structure suggests potential applications in drug development, particularly in targeting specific biological pathways or in the design of molecular probes. Additionally, the presence of the chlorine atom may influence its reactivity and interaction with biological targets. As with many boronic acids, it may exhibit pH-dependent solubility and stability, which are important considerations in its application. Safety data and handling precautions should be observed due to the potential toxicity associated with chlorinated compounds. Overall, this compound represents a versatile building block in synthetic organic chemistry and pharmaceutical research.
Formula:C13H12BClO3
InChI:InChI=1S/C13H12BClO3/c15-11-5-7-12(8-6-11)18-9-10-3-1-2-4-13(10)14(16)17/h1-8,16-17H,9H2
InChI key:InChIKey=KYMMZJKTVPTAKX-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(Cl)C=C1)C2=C(B(O)O)C=CC=C2
Synonyms:
  • B-[2-[(4-Chlorophenoxy)methyl]phenyl]boronic acid
  • Boronic acid, B-[2-[(4-chlorophenoxy)methyl]phenyl]-
  • [2-(4-chlorophenoxyMethyl)phenyl]boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.