CAS 1256358-80-1

B-[3-[(2-Thienylmethoxy)methyl]phenyl]boronic acid

Description:

B-[3-[(2-Thienylmethoxy)methyl]phenyl]boronic acid is a boronic acid derivative characterized by its unique structure, which includes a boron atom bonded to a phenyl group and a thienylmethoxy substituent. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the thienyl group may impart additional electronic and steric properties, influencing its reactivity and solubility. Boronic acids are often utilized in cross-coupling reactions, particularly in the Suzuki-Miyaura reaction, which is a key method for forming carbon-carbon bonds. Furthermore, this compound may exhibit potential biological activity, making it of interest in drug discovery and development. Its solubility and stability in different solvents can vary, which is crucial for its application in laboratory settings. Overall, B-[3-[(2-Thienylmethoxy)methyl]phenyl]boronic acid represents a versatile building block in organic chemistry.

Formula: C₁₂H₁₃BO₃S

InChI: InChI=1S/C12H13BO3S/c14-13(15)11-4-1-3-10(7-11)8-16-9-12-5-2-6-17-12/h1-7,14-15H,8-9H2

InChI key: InChIKey=BLYQDAUIIYVBPR-UHFFFAOYSA-N

SMILES: C(OCC1=CC=CS1)C2=CC(B(O)O)=CC=C2

Synonyms:

• B-[3-[(2-Thienylmethoxy)methyl]phenyl]boronic acid
• Boronic acid, B-[3-[(2-thienylmethoxy)methyl]phenyl]-

3-(Thiophen-2-ylmethoxymethyl)phenylboronic acid

CAS: 1256358-80-1

Formula: C₁₂H₁₃BO₃S

Molecular weight: 248.1058

Ref: IN-DA000O6L