CAS 1256358-87-8

Pyridine, 3-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-

Description:

Pyridine, 3-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a methoxy group at the 3-position enhances its reactivity and solubility in organic solvents. The compound also features a boron-containing moiety, specifically a tetramethyl-1,3,2-dioxaborolane, which is known for its utility in various chemical reactions, including cross-coupling reactions in organic synthesis. This structure suggests potential applications in medicinal chemistry and materials science, particularly in the development of boron-containing compounds for drug discovery or as intermediates in synthetic pathways. The compound's unique functional groups may impart specific properties such as increased lipophilicity or altered electronic characteristics, making it a subject of interest in research and development. Safety and handling precautions should be observed due to the presence of boron and the potential reactivity of the methoxy and pyridine functionalities.

Formula: C₁₂H₁₈BNO₃

InChI: InChI=1S/C12H18BNO3/c1-11(2)12(3,4)17-13(16-11)10-9(15-5)7-6-8-14-10/h6-8H,1-5H3

InChI key: InChIKey=CATWDUWVTQWCFZ-UHFFFAOYSA-N

SMILES: O(C)C1=C(N=CC=C1)B2OC(C)(C)C(C)(C)O2

Synonyms:

• 3-Methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
• Pyridine, 3-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-