CymitQuimica logo

CAS 1256360-08-3

:

2-Methylpropyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-1-carboxylate

Description:
2-Methylpropyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-1-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrrole ring and a dioxaborolane moiety. The presence of the dioxaborolane group suggests potential applications in organic synthesis, particularly in cross-coupling reactions, due to its ability to participate in boron-based chemistry. The compound features a carboxylate functional group, which can enhance its reactivity and solubility in various solvents. The 2-methylpropyl substituent contributes to its hydrophobic characteristics, potentially influencing its interactions in biological systems or materials science. Additionally, the presence of multiple methyl groups in the dioxaborolane structure may impart steric hindrance, affecting the compound's reactivity and stability. Overall, this compound exemplifies the intricate interplay of functional groups that can be tailored for specific applications in medicinal chemistry, agrochemicals, or materials development. As with any chemical substance, safety and handling precautions should be observed due to potential hazards associated with its use.
Formula:C15H24BNO4
InChI:InChI=1S/C15H24BNO4/c1-11(2)10-19-13(18)17-8-7-12(9-17)16-20-14(3,4)15(5,6)21-16/h7-9,11H,10H2,1-6H3
InChI key:InChIKey=HTEFZJVMSRRGOG-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CN(C(OCC(C)C)=O)C=C2
Synonyms:
  • 2-Methylpropyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-1-carboxylate
  • 1H-Pyrrole-1-carboxylic acid, 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 2-methylpropyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.