CymitQuimica logo

CAS 1256360-18-5

:

2-(4-Chloro-2-fluoro-5-propoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-(4-Chloro-2-fluoro-5-propoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a substituted phenyl group. The presence of chlorine and fluorine atoms on the phenyl ring contributes to its potential reactivity and lipophilicity, while the propoxy group enhances solubility in organic solvents. The dioxaborolane moiety is known for its stability and ability to participate in various chemical reactions, particularly in the context of organoboron chemistry, where it can serve as a precursor for boron-containing reagents. This compound may exhibit interesting properties such as selective reactivity in cross-coupling reactions, making it valuable in synthetic organic chemistry and material science. Additionally, its structural complexity suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. Overall, this compound exemplifies the diverse chemistry associated with boron compounds and their utility in advanced chemical synthesis.
Formula:C15H21BClFO3
InChI:InChI=1S/C15H21BClFO3/c1-6-7-19-13-8-10(12(18)9-11(13)17)16-20-14(2,3)15(4,5)21-16/h8-9H,6-7H2,1-5H3
InChI key:InChIKey=ATFCCDUHYXYSHT-UHFFFAOYSA-N
SMILES:FC=1C(=CC(OCCC)=C(Cl)C1)B2OC(C)(C)C(C)(C)O2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.