CAS 1256360-19-6
:2-(5-Butoxy-4-chloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Description:
2-(5-Butoxy-4-chloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a substituted phenyl group. The presence of the butoxy group and halogen substituents (chlorine and fluorine) on the phenyl ring contributes to its chemical reactivity and potential applications in various fields, such as pharmaceuticals and materials science. The dioxaborolane moiety is known for its ability to participate in cross-coupling reactions, making this compound potentially useful in synthetic organic chemistry. Additionally, the steric bulk provided by the tetramethyl groups enhances the stability of the compound and may influence its solubility and interaction with other molecules. Overall, this compound's distinctive functional groups and structural characteristics suggest it may serve as a valuable intermediate in the synthesis of more complex organic molecules or as a reagent in chemical reactions.
Formula:C16H23BClFO3
InChI:InChI=1S/C16H23BClFO3/c1-6-7-8-20-14-9-11(13(19)10-12(14)18)17-21-15(2,3)16(4,5)22-17/h9-10H,6-8H2,1-5H3
InChI key:InChIKey=VJPPDDVGGRCXTM-UHFFFAOYSA-N
SMILES:FC=1C(=CC(OCCCC)=C(Cl)C1)B2OC(C)(C)C(C)(C)O2
Synonyms:- 1,3,2-Dioxaborolane, 2-(5-butoxy-4-chloro-2-fluorophenyl)-4,4,5,5-tetramethyl-
- 2-(5-Butoxy-4-chloro-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 5-Butoxy-4-chloro-2-fluorophenylboronic acid, pinacol ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Butoxy-4-chloro-2-fluorophenylboronic acid, pinacol ester
CAS:Formula:C16H23BClFO3Molecular weight:328.6144
