CymitQuimica logo

CAS 1256360-35-6

:

N-[2-Nitro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenemethanamine

Description:
N-[2-Nitro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenemethanamine is a complex organic compound characterized by its unique functional groups and structural features. It contains a nitro group, which is known for its electron-withdrawing properties, and a boron-containing moiety, specifically a dioxaborolane, which can participate in various chemical reactions, including Suzuki coupling. The presence of multiple aromatic rings contributes to its stability and potential for π-π stacking interactions. This compound may exhibit interesting properties such as fluorescence or photochemical reactivity due to its conjugated system. Additionally, the tetramethyl groups enhance its steric bulk, potentially influencing its reactivity and solubility in organic solvents. The amine functional group suggests potential for further derivatization, making it a candidate for applications in organic synthesis or materials science. Overall, this compound's intricate structure and functional diversity make it a subject of interest in various fields, including medicinal chemistry and materials development.
Formula:C19H23BN2O4
InChI:InChI=1S/C19H23BN2O4/c1-18(2)19(3,4)26-20(25-18)15-11-8-12-16(22(23)24)17(15)21-13-14-9-6-5-7-10-14/h5-12,21H,13H2,1-4H3
InChI key:InChIKey=NDECCQMBNWZQTQ-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)C2=C(B3OC(C)(C)C(C)(C)O3)C=CC=C2N(=O)=O
Synonyms:
  • N-[2-Nitro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenemethanamine
  • Benzenemethanamine, N-[2-nitro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.