CAS 1256467-29-4
:1-Methoxy-2,3-dimethyl-4-(2-propen-1-yl)benzene
Description:
1-Methoxy-2,3-dimethyl-4-(2-propen-1-yl)benzene, also known by its CAS number 1256467-29-4, is an organic compound characterized by its aromatic structure, which includes a methoxy group and multiple methyl substituents on the benzene ring. This compound features a propenyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of the methoxy group enhances its solubility in organic solvents and may influence its electronic properties, making it a candidate for various chemical reactions, including electrophilic substitutions. The dimethyl groups provide steric hindrance, which can affect the compound's reactivity and stability. Additionally, the compound's structure suggests potential uses in the fragrance industry or as an intermediate in the synthesis of more complex organic molecules. Its physical properties, such as boiling point and melting point, would typically be influenced by the molecular structure and substituents, but specific values would require empirical measurement or literature reference. Overall, this compound exemplifies the diversity of substituted aromatic compounds in organic chemistry.
Formula:C12H16O
InChI:InChI=1S/C12H16O/c1-5-6-11-7-8-12(13-4)10(3)9(11)2/h5,7-8H,1,6H2,2-4H3
InChI key:InChIKey=YDRVHISFZWQGFS-UHFFFAOYSA-N
SMILES:C(C=C)C1=C(C)C(C)=C(OC)C=C1
Synonyms:- 1-Methoxy-2,3-dimethyl-4-(2-propen-1-yl)benzene
- Benzene, 1-methoxy-2,3-dimethyl-4-(2-propen-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.