CAS 1256471-77-8
:1,3-Difluoro-2-methoxy-5-(2-propen-1-yl)benzene
Description:
1,3-Difluoro-2-methoxy-5-(2-propen-1-yl)benzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two fluorine atoms, a methoxy group, and a propenyl side chain. The presence of the difluoro substituents indicates that the compound may exhibit unique reactivity and stability compared to its non-fluorinated counterparts. The methoxy group contributes to the compound's polarity and can influence its solubility in various solvents. The propenyl group introduces a site for potential further chemical reactions, such as polymerization or addition reactions. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and utility in synthetic applications. Its specific properties, such as boiling point, melting point, and reactivity, would depend on the molecular interactions and the overall electronic environment created by the substituents on the benzene ring.
Formula:C10H10F2O
InChI:InChI=1S/C10H10F2O/c1-3-4-7-5-8(11)10(13-2)9(12)6-7/h3,5-6H,1,4H2,2H3
InChI key:InChIKey=CPUUOIALSCPYBE-UHFFFAOYSA-N
SMILES:O(C)C1=C(F)C=C(CC=C)C=C1F
Synonyms:- Benzene, 1,3-difluoro-2-methoxy-5-(2-propen-1-yl)-
- 1,3-Difluoro-2-methoxy-5-(2-propen-1-yl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.