CAS 1256477-03-8

2,6-Difluoro-3-methylbenzeneacetaldehyde

Description:

2,6-Difluoro-3-methylbenzeneacetaldehyde is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two fluorine atoms and a methyl group, along with an aldehyde functional group. The presence of the difluoro and methyl substituents influences its chemical reactivity and physical properties, such as boiling point and solubility. Typically, compounds like this may exhibit moderate polarity due to the electronegative fluorine atoms, which can affect intermolecular interactions. The aldehyde group contributes to its reactivity, making it susceptible to oxidation and nucleophilic addition reactions. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in synthesis and as a building block for more complex molecules. Safety data should be consulted for handling, as fluorinated compounds can pose specific health and environmental risks. Overall, 2,6-Difluoro-3-methylbenzeneacetaldehyde represents a unique structure with diverse chemical properties.

Formula: C₉H₈F₂O

InChI: InChI=1S/C9H8F2O/c1-6-2-3-8(10)7(4-5-12)9(6)11/h2-3,5H,4H2,1H3

InChI key: InChIKey=MGNQYTOEJIWIOC-UHFFFAOYSA-N

SMILES: C(C=O)C1=C(F)C(C)=CC=C1F

Synonyms:

• Benzeneacetaldehyde, 2,6-difluoro-3-methyl-
• 2,6-Difluoro-3-methylbenzeneacetaldehyde