CAS 1256478-42-8
:6-Chloro-2-(iodomethyl)thiazolo[5,4-b]pyridine
Description:
6-Chloro-2-(iodomethyl)thiazolo[5,4-b]pyridine is a heterocyclic compound characterized by its thiazole and pyridine rings, which contribute to its unique chemical properties. The presence of chlorine and iodomethyl groups enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is typically used in medicinal chemistry and material science due to its ability to interact with biological targets and its potential as a building block in the synthesis of more complex molecules. Its structural features suggest that it may exhibit interesting biological activities, although specific biological data would depend on empirical studies. Additionally, the compound's solubility, stability, and reactivity can vary based on the solvent and conditions used, which are important considerations for its application in research and development. Overall, 6-Chloro-2-(iodomethyl)thiazolo[5,4-b]pyridine represents a versatile structure in organic synthesis and pharmaceutical development.
Formula:C7H4ClIN2S
InChI:InChI=1S/C7H4ClIN2S/c8-4-1-5-7(10-3-4)12-6(2-9)11-5/h1,3H,2H2
InChI key:InChIKey=ZVZBZULFEKBKDB-UHFFFAOYSA-N
SMILES:C(I)C=1SC=2C(N1)=CC(Cl)=CN2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
