
CAS 1256479-72-7
:Ethyl 3-chloro-2,6-difluorobenzeneacetate
Description:
Ethyl 3-chloro-2,6-difluorobenzeneacetate is an organic compound characterized by its ester functional group, which is derived from the reaction of ethyl alcohol and a substituted aromatic acid. The presence of chlorine and fluorine atoms in its structure contributes to its unique chemical properties, including increased lipophilicity and potential reactivity in various chemical reactions. This compound typically exhibits a moderate boiling point and melting point, influenced by the halogen substituents and the ester group. Ethyl 3-chloro-2,6-difluorobenzeneacetate may be used in synthetic organic chemistry as an intermediate for the production of more complex molecules or in the development of pharmaceuticals. Its reactivity can be attributed to the electrophilic nature of the aromatic ring, making it a candidate for electrophilic substitution reactions. Additionally, the presence of halogens can enhance its biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.
Formula:C10H9ClF2O2
InChI:InChI=1S/C10H9ClF2O2/c1-2-15-9(14)5-6-8(12)4-3-7(11)10(6)13/h3-4H,2,5H2,1H3
InChI key:InChIKey=KEHAPZJWTOOOKD-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)C1=C(F)C(Cl)=CC=C1F
Synonyms:- Ethyl 3-chloro-2,6-difluorobenzeneacetate
- Benzeneacetic acid, 3-chloro-2,6-difluoro-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.