CAS 1256483-32-5
:4-Amino-2-chlorobenzenecarbothioamide
Description:
4-Amino-2-chlorobenzenecarbothioamide is an organic compound characterized by the presence of an amino group, a chlorobenzene ring, and a carbothioamide functional group. Its molecular structure features a chlorine atom attached to the benzene ring at the second position and an amino group at the fourth position, which influences its reactivity and potential applications. The carbothioamide group contributes to its properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and condensation reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Safety data should be consulted for handling, as compounds with amino and halogen substituents can pose health risks. Overall, 4-Amino-2-chlorobenzenecarbothioamide represents a versatile structure in organic synthesis and pharmaceutical research.
Formula:C7H7ClN2S
InChI:InChI=1S/C7H7ClN2S/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,9H2,(H2,10,11)
InChI key:InChIKey=KRNFZYMKATXLGD-UHFFFAOYSA-N
SMILES:C(N)(=S)C1=C(Cl)C=C(N)C=C1
Synonyms:- Benzenecarbothioamide, 4-amino-2-chloro-
- 4-Amino-2-chlorobenzenecarbothioamide
- 4-AMino-2-chlorothiobenzaMide, 97%
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
