CAS 125652-55-3
:3-Methyl-N-Butylpyridinium Chloride
Description:
3-Methyl-N-Butylpyridinium Chloride is an ionic liquid characterized by its unique structure, which includes a pyridinium ring substituted with a methyl group and a butyl group. This compound typically exhibits a low melting point, making it liquid at room temperature, which is a common trait of ionic liquids. It is known for its thermal stability and relatively low volatility, which makes it suitable for various applications, including as a solvent in chemical reactions and as an electrolyte in electrochemical devices. The presence of the chloride ion contributes to its solubility in polar solvents. Additionally, 3-Methyl-N-Butylpyridinium Chloride may exhibit interesting properties such as ionic conductivity and the ability to dissolve a wide range of organic and inorganic compounds. Its unique characteristics make it a subject of interest in fields such as green chemistry, materials science, and electrochemistry, where it can be utilized for sustainable processes and innovative applications.
Formula:C10H16ClN
InChI:InChI=1/C10H16N.ClH/c1-3-4-7-11-8-5-6-10(2)9-11;/h5-6,8-9H,3-4,7H2,1-2H3;1H/q+1;/p-1
Synonyms:- N-Butyl-3-Methylpyridinium Chloride
- 1-Butyl-3-Methylpyridinium Chloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pyridinium, 1-butyl-3-methyl-, chloride (1:1)
CAS:Formula:C10H16ClNPurity:97%Color and Shape:SolidMolecular weight:185.69371-Butyl-3-methylpyridinium chloride
CAS:1-Butyl-3-methylpyridinium chloridePurity:99%Molecular weight:185.69g/mol1-Butyl-3-methylpyridinium Chloride
CAS:Formula:C10H16ClNPurity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow to Dark green powder to crystalMolecular weight:185.701-Butyl-3-methylpyridinium Chloride
CAS:Formula:C10H16ClNPurity:97%Color and Shape:Liquid, No data available.Molecular weight:185.7



