CAS 1256546-76-5: 2-Oxaspiro[3.5]nonane-7-methanol

Description:2-Oxaspiro[3.5]nonane-7-methanol is a chemical compound characterized by its unique spirocyclic structure, which features a bicyclic framework with an ether linkage and a hydroxymethyl group. The presence of the oxaspiro moiety indicates that it contains an oxygen atom integrated into the spiro structure, contributing to its potential reactivity and solubility properties. This compound may exhibit interesting stereochemistry due to the spiro arrangement, which can influence its interactions with biological systems or other chemical entities. The hydroxymethyl group suggests that it could participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, compounds with such structures are often investigated for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the overall environment in which the compound is studied. Further characterization through techniques like NMR, IR spectroscopy, or mass spectrometry would provide more detailed insights into its chemical behavior and potential applications.

Formula:C₉H₁₆O₂

InChI:InChI=1S/C9H16O2/c10-5-8-1-3-9(4-2-8)6-11-7-9/h8,10H,1-7H2

InChI key:InChIKey=ZZXZJRYFNGVOKW-UHFFFAOYSA-N

SMILES:OCC1CCC2(COC2)CC1

Synonyms:
2-Oxaspiro[3.5]nonane-7-methanol
(2-Oxaspiro[3.5]nonan-7-yl)methanol

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-Oxaspiro[3.5]nonane-7-methanol REF: IN-DA000O9MCAS: 1256546-76-5	96%	To inquire	Mon 24 Mar 25
2-oxaspiro[3.5]nonan-7-ylmethanol REF: 10-F054907CAS: 1256546-76-5	95.0%	250.00 €~2,941.00 €	Tue 25 Mar 25
2-Oxaspiro[3.5]nonan-7-ylmethanol REF: 54-OR312288CAS: 1256546-76-5	- - -	228.00 €~832.00 €	Mon 31 Mar 25
2-oxaspiro[3.5]nonan-7-ylmethanol REF: 3D-GAC54676CAS: 1256546-76-5	Min. 95%	- - -	Discontinued product