
CAS 1256562-04-5
:5-(Bromomethyl)-2-chloro-1-methyl-1H-imidazole
Description:
5-(Bromomethyl)-2-chloro-1-methyl-1H-imidazole is a heterocyclic organic compound characterized by its imidazole ring, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a bromomethyl group and a chloro substituent on the imidazole ring contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure suggests that it could participate in nucleophilic substitution reactions due to the electrophilic nature of the bromomethyl and chloro groups. The imidazole moiety is known for its biological activity, making this compound of interest in the development of pharmaceuticals. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental concerns. Overall, 5-(Bromomethyl)-2-chloro-1-methyl-1H-imidazole is a versatile compound with potential applications in various fields of chemistry.
Formula:C5H6BrClN2
InChI:InChI=1S/C5H6BrClN2/c1-9-4(2-6)3-8-5(9)7/h3H,2H2,1H3
InChI key:InChIKey=OKQLUMOTTLRROT-UHFFFAOYSA-N
SMILES:C(Br)C=1N(C)C(Cl)=NC1
Synonyms:- 1H-Imidazole, 5-(bromomethyl)-2-chloro-1-methyl-
- 5-(Bromomethyl)-2-chloro-1-methyl-1H-imidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.