
CAS 1256562-29-4
:4-Methyl-1-(1-methylethyl)-1H-imidazole-5-carboxaldehyde
Description:
4-Methyl-1-(1-methylethyl)-1H-imidazole-5-carboxaldehyde is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a carboxaldehyde functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of a methyl group and an isopropyl group enhances its steric properties and may influence its solubility and interaction with other molecules. Typically, compounds like this can exhibit biological activity, making them of interest in medicinal chemistry. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. Its CAS number, 1256562-29-4, allows for precise identification in chemical databases, facilitating research and development. Overall, 4-Methyl-1-(1-methylethyl)-1H-imidazole-5-carboxaldehyde is a compound of interest due to its unique structural features and potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H12N2O
InChI:InChI=1S/C8H12N2O/c1-6(2)10-5-9-7(3)8(10)4-11/h4-6H,1-3H3
InChI key:InChIKey=QXAMCMFRMYDGEI-UHFFFAOYSA-N
SMILES:C(=O)C=1N(C(C)C)C=NC1C
Synonyms:- 4-Methyl-1-(1-methylethyl)-1H-imidazole-5-carboxaldehyde
- 1H-Imidazole-5-carboxaldehyde, 4-methyl-1-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.