CAS 1256579-00-6

9-Bromo-6,11-dihydro-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazole-3-carbonitrile

Description:

9-Bromo-6,11-dihydro-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazole-3-carbonitrile is a complex organic compound characterized by its unique structure, which includes a benzo[b]carbazole core, a bromine substituent, and a methoxy group. This compound features a carbonitrile functional group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of multiple methyl groups enhances its hydrophobic character, influencing its solubility and interaction with biological systems. The bromine atom can serve as a site for further chemical modifications, making it a versatile intermediate in synthetic pathways. Additionally, the compound's structural features may impart specific biological activities, warranting investigation for potential pharmaceutical applications. Its molecular complexity suggests that it may exhibit interesting electronic properties, which could be relevant in materials science or as a dye. Overall, this compound represents a significant example of functionalized heterocycles in organic chemistry.

Formula: C₂₀H₁₇BrN₂O

InChI: InChI=1S/C20H17BrN2O/c1-20(2)15-9-18(24-3)16(21)8-12(15)7-14-13-5-4-11(10-22)6-17(13)23-19(14)20/h4-6,8-9,23H,7H2,1-3H3

InChI key: InChIKey=PVNHNJNRGGUTKX-UHFFFAOYSA-N

SMILES: CC1(C)C2=C(C=3C(N2)=CC(C#N)=CC3)CC=4C1=CC(OC)=C(Br)C4

Synonyms:

• 5H-Benzo[b]carbazole-3-carbonitrile, 9-bromo-6,11-dihydro-8-methoxy-6,6-dimethyl-
• 9-Bromo-6,11-dihydro-8-methoxy-6,6-dimethyl-5H-benzo[b]carbazole-3-carbonitrile