CymitQuimica logo

CAS 1256627-72-1

:

2-Chloro-N-(8,8a-dihydro-6-methyl-7-oxo-7H-thiazolo[3,2-b][1,2,4]triazin-3-yl)acetamide

Description:
2-Chloro-N-(8,8a-dihydro-6-methyl-7-oxo-7H-thiazolo[3,2-b][1,2,4]triazin-3-yl)acetamide is a chemical compound characterized by its complex structure, which includes a thiazolo-triazin moiety. This compound features a chloro substituent and an acetamide functional group, contributing to its potential reactivity and biological activity. The thiazolo-triazin framework suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique heterocyclic structure that may interact with biological targets. The presence of the chloro group can enhance lipophilicity and influence the compound's solubility and permeability. Additionally, the 6-methyl and 7-oxo groups may play a role in the compound's stability and reactivity. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the fields of drug discovery and development, where its specific interactions and effects can be explored.
Formula:C8H9ClN4O2S
InChI:InChI=1S/C8H9ClN4O2S/c1-4-7(15)11-8-13(12-4)5(3-16-8)10-6(14)2-9/h3,8H,2H2,1H3,(H,10,14)(H,11,15)
InChI key:InChIKey=ZHALGNAGGUQCGZ-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C=1N2C(NC(=O)C(C)=N2)SC1
Synonyms:
  • 2-Chloro-N-(8,8a-dihydro-6-methyl-7-oxo-7H-thiazolo[3,2-b][1,2,4]triazin-3-yl)acetamide
  • Acetamide, 2-chloro-N-(8,8a-dihydro-6-methyl-7-oxo-7H-thiazolo[3,2-b][1,2,4]triazin-3-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.