CAS 1256627-91-4
:1-[7-Hydroxy-2-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone
Description:
1-[7-Hydroxy-2-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone, with the CAS number 1256627-91-4, is a chemical compound characterized by its complex heterocyclic structure, which includes a triazole and pyrimidine moiety. This compound features a trifluoromethyl group, which enhances its lipophilicity and may influence its biological activity. The presence of a hydroxyl group contributes to its potential as a hydrogen bond donor, while the ethanone functional group suggests reactivity typical of ketones. The unique arrangement of atoms within the triazolo and pyrimidine rings may impart specific pharmacological properties, making it of interest in medicinal chemistry. Such compounds are often investigated for their potential therapeutic applications, including antiviral or anticancer activities. Additionally, the trifluoromethyl group is known to improve metabolic stability and bioavailability. Overall, this compound exemplifies the intricate design often found in drug development, where structural features are tailored to optimize efficacy and safety profiles.
Formula:C8H5F3N4O2
InChI:InChI=1S/C8H5F3N4O2/c1-3(16)4-2-12-7-13-6(8(9,10)11)14-15(7)5(4)17/h2,17H,1H3
InChI key:InChIKey=CCLNLZJQVLNBFL-UHFFFAOYSA-N
SMILES:OC=1N2C(=NC(C(F)(F)F)=N2)N=CC1C(C)=O
Synonyms:- 1-[7-Hydroxy-2-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]ethanone
- Ethanone, 1-[7-hydroxy-2-(trifluoromethyl)[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.