CAS 1256627-95-8

3-Bromo-1-(3-methylphenyl)-1H-pyrrole-2,5-dione

Description:

3-Bromo-1-(3-methylphenyl)-1H-pyrrole-2,5-dione is a chemical compound characterized by its unique structure, which includes a pyrrole ring substituted with a bromine atom and a 3-methylphenyl group. This compound belongs to the class of pyrrole derivatives, which are known for their diverse biological activities and potential applications in pharmaceuticals and agrochemicals. The presence of the bromine atom introduces halogenation, which can enhance the compound's reactivity and influence its interactions with biological targets. The 3-methylphenyl substituent contributes to the compound's lipophilicity, potentially affecting its solubility and permeability in biological systems. Additionally, the diketone functional groups in the pyrrole ring may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Overall, 3-Bromo-1-(3-methylphenyl)-1H-pyrrole-2,5-dione exhibits characteristics that make it a subject of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₁₁H₈BrNO₂

InChI: InChI=1S/C11H8BrNO2/c1-7-3-2-4-8(5-7)13-10(14)6-9(12)11(13)15/h2-6H,1H3

InChI key: InChIKey=PMFLGDIKXLLQIF-UHFFFAOYSA-N

SMILES: O=C1N(C2=CC(C)=CC=C2)C(=O)C(Br)=C1

Synonyms:

• 3-Bromo-1-(3-methylphenyl)-1H-pyrrole-2,5-dione
• 3-Bromo-1-(3-methylphenyl)-2,5-dihydro-1H-pyrrole-2,5-dione
• 3-Bromo-1-(3-methylphenyl)pyrrole-2,5-dione
• 3-Bromo-1-m-tolyl-pyrrole-2,5-dione
• 1H-Pyrrole-2,5-dione, 3-bromo-1-(3-methylphenyl)-