CAS 1256628-06-4
:2-Oxazolidinone, 5-(chloromethyl)-3-(4,6-dimethyl-2-pyrimidinyl)-
Description:
2-Oxazolidinone, 5-(chloromethyl)-3-(4,6-dimethyl-2-pyrimidinyl)- is a heterocyclic organic compound characterized by the presence of an oxazolidinone ring, which is a five-membered lactam containing both nitrogen and oxygen atoms. The compound features a chloromethyl group at the 5-position and a pyrimidine moiety substituted at the 3-position with two methyl groups at the 4 and 6 positions. This structural arrangement contributes to its potential biological activity and makes it of interest in medicinal chemistry. The presence of the chloromethyl group may enhance reactivity, allowing for further chemical modifications or interactions with biological targets. The pyrimidine ring is known for its role in various biological processes, including nucleic acid structure and function. Overall, this compound's unique structure suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or anticancer agents, although specific biological activities would require further investigation.
Formula:C10H12ClN3O2
InChI:InChI=1S/C10H12ClN3O2/c1-6-3-7(2)13-9(12-6)14-5-8(4-11)16-10(14)15/h3,8H,4-5H2,1-2H3
InChI key:InChIKey=WANYDHPJNOXTDI-UHFFFAOYSA-N
SMILES:O=C1N(C=2N=C(C)C=C(C)N2)CC(CCl)O1
Synonyms:- 5-Chloromethyl-3-(4,6-dimethyl-pyrimidin-2-yl)-oxazolidin-2-one
- 2-Oxazolidinone, 5-(chloromethyl)-3-(4,6-dimethyl-2-pyrimidinyl)-
- 5-(Chloromethyl)-3-(4,6-dimethylpyrimidin-2-yl)-1,3-oxazolidin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.