CAS 1256628-07-5

Carbamic acid, N-(4-amino-1,2,5-oxadiazol-3-yl)-, methyl ester

Description:

Carbamic acid, N-(4-amino-1,2,5-oxadiazol-3-yl)-, methyl ester is a chemical compound characterized by its carbamate functional group, which is derived from carbamic acid. This compound features a methyl ester group, indicating that it has a methoxy (-OCH3) substituent attached to the carbamic acid moiety. The presence of the 4-amino-1,2,5-oxadiazol-3-yl group suggests that it has potential biological activity, as oxadiazoles are often associated with various pharmacological properties. The structure implies that it may participate in hydrogen bonding due to the amino group, which can enhance its solubility in polar solvents. Additionally, the compound may exhibit stability under standard conditions, but its reactivity could be influenced by the presence of the amino and ester functionalities. Overall, this compound may be of interest in medicinal chemistry and agricultural applications, particularly in the development of new therapeutic agents or agrochemicals. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₄H₆N₄O₃

InChI: InChI=1S/C4H6N4O3/c1-10-4(9)6-3-2(5)7-11-8-3/h1H3,(H2,5,7)(H,6,8,9)

InChI key: InChIKey=XBVVCTSQMFSUSL-UHFFFAOYSA-N

SMILES: N(C(OC)=O)C=1C(N)=NON1

Synonyms:

• Methyl N-(4-amino-1,2,5-oxadiazol-3-yl)carbamate
• Carbamic acid, N-(4-amino-1,2,5-oxadiazol-3-yl)-, methyl ester