CAS 1256628-15-5

1,2,3,4-Tetrahydro-2,2,4-trimethyl-8-quinolinecarboxylic acid

Description:

1,2,3,4-Tetrahydro-2,2,4-trimethyl-8-quinolinecarboxylic acid is a chemical compound characterized by its complex bicyclic structure, which includes a quinoline moiety. This compound features a tetrahydroquinoline framework, indicating that it has undergone partial hydrogenation, resulting in a saturated ring system. The presence of multiple methyl groups contributes to its hydrophobic nature and may influence its solubility and reactivity. The carboxylic acid functional group is significant for its potential to participate in acid-base reactions and can serve as a site for further chemical modifications. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, boiling point, and spectral characteristics, would depend on its molecular interactions and the environment in which it is studied. Overall, 1,2,3,4-Tetrahydro-2,2,4-trimethyl-8-quinolinecarboxylic acid represents a unique structure with potential applications in various chemical and pharmaceutical contexts.

Formula: C₁₃H₁₇NO₂

InChI: InChI=1S/C13H17NO2/c1-8-7-13(2,3)14-11-9(8)5-4-6-10(11)12(15)16/h4-6,8,14H,7H2,1-3H3,(H,15,16)

InChI key: InChIKey=XZQXSBCITTWAJB-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(C(C)CC(C)(C)N2)=CC=C1

Synonyms:

• 2,2,4-Trimethyl-1,2,3,4-tetrahydro-quinoline-8-carboxylic acid
• 2,2,4-Trimethyl-1,2,3,4-tetrahydroquinoline-8-carboxylic acid
• 1,2,3,4-Tetrahydro-2,2,4-trimethyl-8-quinolinecarboxylic acid
• 8-Quinolinecarboxylic acid, 1,2,3,4-tetrahydro-2,2,4-trimethyl-
• 2,2,4-Trimethyl-3,4-dihydro-1H-quinoline-8-carboxylic acid

2,2,4-Trimethyl-1,2,3,4-tetrahydroquinoline-8-carboxylic acid

CAS: 1256628-15-5

2,2,4-Trimethyl-1,2,3,4-tetrahydroquinoline-8-carboxylic acid is a versatile building block that can be used as a reagent or speciality chemical in research and development. It is also an intermediate for the synthesis of complex compounds with various properties. This compound has been shown to be useful as a building block for the synthesis of new compounds with potential pharmaceutical applications.

Formula: C₁₃H₁₇NO₂

Purity: Min. 95%

Color and Shape: White Off-White Powder

Molecular weight: 219.28 g/mol

Ref: 3D-FT125582