CAS 1256633-30-3: Methyl 5-fluoro-2-[4-(phenylmethyl)-1-piperazinyl]benzoate

Description:Methyl 5-fluoro-2-[4-(phenylmethyl)-1-piperazinyl]benzoate, with the CAS number 1256633-30-3, is a chemical compound characterized by its complex structure, which includes a benzoate moiety, a fluorine atom, and a piperazine ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, while the piperazine ring is often associated with pharmacological properties, particularly in the development of psychoactive and therapeutic agents. The phenylmethyl group adds to the compound's hydrophobic character, influencing its interaction with biological targets. Methyl esters, like this compound, are generally known for their reactivity in various chemical reactions, including hydrolysis and transesterification. Overall, the unique combination of functional groups in this molecule suggests potential applications in medicinal chemistry, particularly in the design of new pharmaceuticals targeting central nervous system disorders or other therapeutic areas.

Formula:C₁₉H₂₁FN₂O₂

InChI:InChI=1S/C19H21FN2O2/c1-24-19(23)17-13-16(20)7-8-18(17)22-11-9-21(10-12-22)14-15-5-3-2-4-6-15/h2-8,13H,9-12,14H2,1H3

InChI key:InChIKey=AGPAGDTZNRMSLV-UHFFFAOYSA-N

SMILES:O=C(OC)C1=CC(F)=CC=C1N2CCN(CC=3C=CC=CC3)CC2

Synonyms:
Benzoic acid, 5-fluoro-2-[4-(phenylmethyl)-1-piperazinyl]-, methyl ester
Methyl 5-fluoro-2-[4-(phenylmethyl)-1-piperazinyl]benzoate

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	Benzoic acid, 5-fluoro-2-[4-(phenylmethyl)-1-piperazinyl]-, methyl ester REF: IN-DA000OB9CAS: 1256633-30-3	≥95%	To inquire	Tue 12 Aug 25
	Methyl 2-(4-Benzylpiperazino)-5-fluorobenzoate REF: 3D-GAC63330CAS: 1256633-30-3	Min. 95%	- - -	Discontinued product