CAS 1256633-31-4
:α,α-Dimethyl-5-nitro-2-pyridineacetonitrile
Description:
α,α-Dimethyl-5-nitro-2-pyridineacetonitrile is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a nitro group (-NO2) at the 5-position and a nitrile group (-C≡N) at the 2-position of the pyridine ring, along with two methyl groups attached to the alpha carbon adjacent to the nitrile. The presence of the nitro group contributes to its potential reactivity and polarity, while the nitrile group can participate in various chemical reactions, including nucleophilic additions. The compound is likely to be a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure suggests potential applications in pharmaceuticals or agrochemicals, particularly in the synthesis of more complex molecules. As with many nitro compounds, it may also possess specific safety and handling considerations due to its potential toxicity and reactivity.
Formula:C9H9N3O2
InChI:InChI=1S/C9H9N3O2/c1-9(2,6-10)8-4-3-7(5-11-8)12(13)14/h3-5H,1-2H3
InChI key:InChIKey=WGTZNLRJXIIZEB-UHFFFAOYSA-N
SMILES:C(C#N)(C)(C)C1=CC=C(N(=O)=O)C=N1
Synonyms:- α,α-Dimethyl-5-nitro-2-pyridineacetonitrile
- 2-Methyl-2-(5-nitropyridin-2-yl)propanenitrile
- 2-Pyridineacetonitrile, α,α-dimethyl-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
