CAS 1256633-33-6

Methyl 4,5-di-1H-imidazol-1-yl-2-nitrobenzoate

Description:

Methyl 4,5-di-1H-imidazol-1-yl-2-nitrobenzoate is a chemical compound characterized by its complex structure, which includes both imidazole and nitrobenzene functionalities. The presence of the imidazole rings suggests potential biological activity, as imidazole derivatives are often found in pharmaceuticals and agrochemicals. The nitro group indicates that this compound may exhibit unique electronic properties, potentially influencing its reactivity and interactions with other molecules. The ester functional group (methyl ester) contributes to its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. Additionally, the compound's molecular structure may allow for specific interactions with biological targets, which could be of interest in drug development. Overall, Methyl 4,5-di-1H-imidazol-1-yl-2-nitrobenzoate is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science, due to its unique combination of functional groups.

Formula: C₁₄H₁₁N₅O₄

InChI: InChI=1S/C14H11N5O4/c1-23-14(20)10-6-12(17-4-2-15-8-17)13(7-11(10)19(21)22)18-5-3-16-9-18/h2-9H,1H3

InChI key: InChIKey=WDEMOZOGTCVBEX-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC(=C(C=C1N(=O)=O)N2C=CN=C2)N3C=CN=C3

Synonyms:

• Benzoic acid, 4,5-di-1H-imidazol-1-yl-2-nitro-, methyl ester
• Methyl 4,5-di-1H-imidazol-1-yl-2-nitrobenzoate

Methyl 4,5-Di(1-imidazolyl)-2-nitrobenzoate

CAS: 1256633-33-6

Formula: C₁₄H₁₁N₅O₄

Molecular weight: 313.2682

Ref: IN-DA000OB6

Methyl 4,5-di(1H-imidazol-1-yl)-2-nitrobenzoate

CAS: 1256633-33-6

Purity: 95.0%

Molecular weight: 313.27301025390625

Ref: 10-F447133