CAS 1256633-34-7

Methyl 4-[[(1,1-dimethylethoxy)carbonyl](2-ethoxy-2-oxoethyl)amino]butanoate

Description:

Methyl 4-[[(1,1-dimethylethoxy)carbonyl](2-ethoxy-2-oxoethyl)amino]butanoate, identified by its CAS number 1256633-34-7, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups such as esters and amines. This compound typically exhibits properties associated with esters, including volatility and a tendency to be less polar compared to other functional groups. It may be soluble in organic solvents and exhibit moderate stability under standard conditions. The presence of the dimethylethoxy and ethoxy groups suggests potential applications in medicinal chemistry or as an intermediate in organic synthesis. Additionally, the compound's structure indicates it may participate in various chemical reactions, including hydrolysis and esterification. Its specific reactivity and interactions would depend on the surrounding conditions, such as pH and temperature. As with many synthetic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.

Formula: C₁₄H₂₅NO₆

InChI: InChI=1S/C14H25NO6/c1-6-20-12(17)10-15(9-7-8-11(16)19-5)13(18)21-14(2,3)4/h6-10H2,1-5H3

InChI key: InChIKey=MQCGNAYZRFOZIL-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)(CC(OCC)=O)CCCC(OC)=O

Synonyms:

• Butanoic acid, 4-[[(1,1-dimethylethoxy)carbonyl](2-ethoxy-2-oxoethyl)amino]-, methyl ester
• Methyl 4-[[(1,1-dimethylethoxy)carbonyl](2-ethoxy-2-oxoethyl)amino]butanoate

Butanoic acid, 4-[[(1,1-dimethylethoxy)carbonyl](2-ethoxy-2-oxoethyl)amino]-, methyl ester

CAS: 1256633-34-7

Formula: C₁₄H₂₅NO₆

Purity: 95%

Molecular weight: 303.3514

Ref: IN-DA000OB5

Methyl 4-((tert-butoxycarbonyl)(2-ethoxy-2-oxoethyl)amino)butanoate

CAS: 1256633-34-7

Formula: C₁₄H₂₅NO₆

Purity: >95%

Molecular weight: 303.355

Ref: 10-F447137