CymitQuimica logo

CAS 1256633-36-9

:

Ethyl 7,8-dihydro-8-oxoimidazo[1,5-a]pyrazine-1-carboxylate

Description:
Ethyl 7,8-dihydro-8-oxoimidazo[1,5-a]pyrazine-1-carboxylate is a chemical compound characterized by its unique imidazo[1,5-a]pyrazine structure, which incorporates both a carboxylate and an oxo group. This compound typically exhibits a molecular formula that reflects its complex ring system and functional groups, contributing to its potential reactivity and biological activity. The presence of the ethyl ester group suggests that it may participate in esterification reactions and could be hydrolyzed under certain conditions. Its structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the imidazo and pyrazine rings. As with many heterocyclic compounds, it may exhibit interesting interactions with biological targets, which could be explored for therapeutic applications. However, detailed studies would be necessary to fully elucidate its properties and potential uses in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H9N3O3
InChI:InChI=1S/C9H9N3O3/c1-2-15-9(14)6-7-8(13)10-3-4-12(7)5-11-6/h3-5H,2H2,1H3,(H,10,13)
InChI key:InChIKey=ZBSXWXNJCBGYKO-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C2N(C=N1)C=CNC2=O
Synonyms:
  • Ethyl 7,8-dihydro-8-oxoimidazo[1,5-a]pyrazine-1-carboxylate
  • Imidazo[1,5-a]pyrazine-1-carboxylic acid, 7,8-dihydro-8-oxo-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.