CAS 1256633-38-1

5-Fluoro-2-[4-(phenylmethyl)-1-piperazinyl]benzoic acid

Description:

5-Fluoro-2-[4-(phenylmethyl)-1-piperazinyl]benzoic acid is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a fluorine atom and a piperazine ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. The piperazine ring is known for its role in pharmacological activity, often contributing to the modulation of neurotransmitter systems. As a benzoic acid derivative, it may exhibit acidic properties, allowing for potential interactions in various chemical environments. The compound's molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups.

Formula: C₁₈H₁₉FN₂O₂

InChI: InChI=1S/C18H19FN2O2/c19-15-6-7-17(16(12-15)18(22)23)21-10-8-20(9-11-21)13-14-4-2-1-3-5-14/h1-7,12H,8-11,13H2,(H,22,23)

InChI key: InChIKey=ULOYDKUTNHOZGG-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC(F)=C1)N2CCN(CC3=CC=CC=C3)CC2

Synonyms:

• 5-Fluoro-2-[4-(phenylmethyl)-1-piperazinyl]benzoic acid
• Benzoic acid, 5-fluoro-2-[4-(phenylmethyl)-1-piperazinyl]-

Benzoic acid, 5-fluoro-2-[4-(phenylmethyl)-1-piperazinyl]-

CAS: 1256633-38-1

Formula: C₁₈H₁₉FN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 314.3541

Ref: IN-DA000OB1

2-(4-BENZYLPIPERAZINO)-5-FLUOROBENZOIC ACID

CAS: 1256633-38-1

Formula: C₁₈H₁₉FN₂O₂

Purity: >97%

Molecular weight: 314.36

Ref: 10-F387508