CymitQuimica logo

CAS 1256636-22-2

:

(4R)-4-Amino-1-methyl-L-proline methyl ester

Description:
(4R)-4-Amino-1-methyl-L-proline methyl ester, with the CAS number 1256636-22-2, is a chiral amino acid derivative that features a proline backbone with an amino group and a methyl ester functional group. This compound is characterized by its specific stereochemistry, indicated by the (4R) configuration, which plays a crucial role in its biological activity and interactions. The presence of the amino group contributes to its potential as a building block in peptide synthesis and drug development. The methyl ester moiety enhances its solubility and stability, making it suitable for various applications in medicinal chemistry. Additionally, this compound may exhibit unique properties such as the ability to act as a neurotransmitter or modulator, depending on its interactions with biological systems. Its structural features and chirality make it an important candidate for research in fields such as pharmacology and biochemistry, where understanding the nuances of amino acid derivatives is essential for developing therapeutic agents.
Formula:C7H14N2O2
InChI:InChI=1S/C7H14N2O2/c1-9-4-5(8)3-6(9)7(10)11-2/h5-6H,3-4,8H2,1-2H3/t5-,6+/m1/s1
InChI key:InChIKey=WWDRZXVUQYMTLY-RITPCOANSA-N
SMILES:C(OC)(=O)[C@@H]1C[C@@H](N)CN1C
Synonyms:
  • L-Proline, 4-amino-1-methyl-, methyl ester, (4R)-
  • (4R)-4-Amino-1-methyl-L-proline methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.