CymitQuimica logo

CAS 1256636-25-5

:

(7R,8aS)-7-Aminohexahydropyrrolo[1,2-a]pyrazine-1,4-dione

Description:
(7R,8aS)-7-Aminohexahydropyrrolo[1,2-a]pyrazine-1,4-dione is a chemical compound characterized by its unique bicyclic structure, which includes a pyrazine ring fused to a pyrrolidine moiety. This compound features an amino group at the 7-position and two carbonyl groups at the 1 and 4 positions, contributing to its potential reactivity and biological activity. The stereochemistry indicated by the (7R,8aS) designation suggests specific spatial arrangements of atoms, which can significantly influence the compound's interactions in biological systems. It is likely to exhibit properties typical of heterocyclic compounds, such as solubility in polar solvents and potential for hydrogen bonding due to the presence of the amino and carbonyl groups. The compound may also be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. However, detailed studies would be necessary to fully elucidate its properties, reactivity, and potential applications.
Formula:C7H11N3O2
InChI:InChI=1S/C7H11N3O2/c8-4-1-5-7(12)9-2-6(11)10(5)3-4/h4-5H,1-3,8H2,(H,9,12)/t4-,5+/m1/s1
InChI key:InChIKey=SBUFSQQFFUNNMJ-UHNVWZDZSA-N
SMILES:O=C1[C@]2(N(C[C@H](N)C2)C(=O)CN1)[H]
Synonyms:
  • Pyrrolo[1,2-a]pyrazine-1,4-dione, 7-aminohexahydro-, (7R,8aS)-
  • (7R,8aS)-7-Aminohexahydropyrrolo[1,2-a]pyrazine-1,4-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.