CAS 1256636-31-3

(2S,4R)-4-Amino-1-methyl-2-pyrrolidinemethanol

Description:

(2S,4R)-4-Amino-1-methyl-2-pyrrolidinemethanol is a chiral organic compound characterized by its pyrrolidine ring structure, which contributes to its unique stereochemistry. The presence of an amino group and a hydroxymethyl group enhances its potential for hydrogen bonding, influencing its solubility and reactivity. This compound is typically a white to off-white solid and is soluble in polar solvents due to its functional groups. Its stereochemistry, indicated by the (2S,4R) configuration, suggests specific spatial arrangements that can affect its biological activity and interactions with other molecules. Such compounds are often of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological systems in a stereospecific manner. The CAS number 1256636-31-3 uniquely identifies this compound in chemical databases, facilitating research and regulatory processes. Overall, (2S,4R)-4-Amino-1-methyl-2-pyrrolidinemethanol exemplifies the complexity and significance of chiral molecules in chemistry and drug design.

Formula: C₆H₁₄N₂O

InChI: InChI=1S/C6H14N2O/c1-8-3-5(7)2-6(8)4-9/h5-6,9H,2-4,7H2,1H3/t5-,6+/m1/s1

InChI key: InChIKey=FHDKMBDQMNUHAC-RITPCOANSA-N

SMILES: C(O)[C@H]1N(C)C[C@H](N)C1

Synonyms:

• (2S,4R)-4-Amino-1-methyl-2-pyrrolidinemethanol
• 2-Pyrrolidinemethanol, 4-amino-1-methyl-, (2S,4R)-
• ((2S,4R)-4-Amino-1-methylpyrrolidin-2-yl)methanol

[(2S,4R)-4-amino-1-methyl-2-pyrrolidinyl]methanol

CAS: 1256636-31-3

Formula: C₆H₁₄N₂O

Purity: 95.0%

Molecular weight: 130.191

Ref: 10-F312320