CAS 1256642-95-1

α-Methyl-1H-imidazole-1-acetic acid hydrazide

Description:

α-Methyl-1H-imidazole-1-acetic acid hydrazide is a chemical compound characterized by its imidazole ring structure, which contributes to its biological activity and potential applications in medicinal chemistry. This compound features a hydrazide functional group, which is known for its reactivity and ability to form various derivatives. The presence of the α-methyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. Typically, compounds of this nature may exhibit antimicrobial, anti-inflammatory, or anticancer activities, making them of interest in drug development. The hydrazide moiety can participate in various chemical reactions, including acylation and condensation, allowing for further functionalization. Additionally, the compound's solubility, stability, and reactivity can be influenced by the pH of the environment, which is crucial for its application in biological systems. Overall, α-Methyl-1H-imidazole-1-acetic acid hydrazide represents a versatile scaffold for further exploration in pharmaceutical research and development.

Formula: C₆H₁₀N₄O

InChI: InChI=1S/C6H10N4O/c1-5(6(11)9-7)10-3-2-8-4-10/h2-5H,7H2,1H3,(H,9,11)

InChI key: InChIKey=PVXAXHKUVLHXAH-UHFFFAOYSA-N

SMILES: C(C(NN)=O)(C)N1C=CN=C1

Synonyms:

• 1H-Imidazole-1-acetic acid, α-methyl-, hydrazide
• α-Methyl-1H-imidazole-1-acetic acid hydrazide