CAS 1256643-15-8

4-Ethyl-4-piperidinemethanol

Description:

4-Ethyl-4-piperidinemethanol is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features an ethyl group and a hydroxymethyl group attached to the piperidine nitrogen, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the hydroxymethyl group suggests that it may exhibit hydrogen bonding capabilities, potentially influencing its solubility in polar solvents. Additionally, the ethyl substituent can affect the compound's lipophilicity, making it more soluble in organic solvents. 4-Ethyl-4-piperidinemethanol may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. However, specific data regarding its toxicity, stability, and reactivity would require further investigation and should be handled with appropriate safety measures in a laboratory setting.

Formula: C₈H₁₇NO

InChI: InChI=1S/C8H17NO/c1-2-8(7-10)3-5-9-6-4-8/h9-10H,2-7H2,1H3

InChI key: InChIKey=GDDYZIOQRPFFAR-UHFFFAOYSA-N

SMILES: C(C)C1(CO)CCNCC1

Synonyms:

• 4-Ethyl-4-piperidinemethanol
• 4-Piperidinemethanol, 4-ethyl-
• (4-Ethylpiperidin-4-yl)methanol

(4-Ethylpiperidin-4-yl)methanol

CAS: 1256643-15-8

(4-Ethylpiperidin-4-yl)methanol

Purity: 98%

Molecular weight: 143.23g/mol

Ref: 54-OR1061915