CAS 1256643-38-5

9-Hydroxy-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxylic acid

Description:

9-Hydroxy-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxylic acid, with the CAS number 1256643-38-5, is a heterocyclic compound characterized by its complex bicyclic structure that incorporates both pyridine and pyrimidine rings. This compound features a hydroxyl group and a carboxylic acid functional group, which contribute to its potential as a bioactive molecule. The presence of the keto group enhances its reactivity and may influence its interactions in biological systems. Typically, such compounds exhibit a range of biological activities, including antimicrobial and antitumor properties, making them of interest in medicinal chemistry. The solubility and stability of this compound can vary depending on the pH and solvent conditions, which are crucial for its application in pharmaceutical formulations. Additionally, its structural features may allow for various derivatizations, potentially leading to the development of novel therapeutic agents. Overall, 9-Hydroxy-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxylic acid represents a significant class of compounds with diverse applications in drug discovery and development.

Formula: C₉H₆N₂O₄

InChI: InChI=1S/C9H6N2O4/c12-6-2-1-3-11-7(6)10-4-5(8(11)13)9(14)15/h1-4,12H,(H,14,15)

InChI key: InChIKey=LYFDMKUCZBAGTG-UHFFFAOYSA-N

SMILES: O=C1N2C(=NC=C1C(O)=O)C(O)=CC=C2

Synonyms:

• 4H-Pyrido[1,2-a]pyrimidine-3-carboxylic acid, 9-hydroxy-4-oxo-
• 9-Hydroxy-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxylic acid

9-Hydroxy-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxylic acid

CAS: 1256643-38-5

Formula: C₉H₆N₂O₄

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 206.157

Ref: 10-F312897