CAS 1256643-42-1

7-Methyl-1,2,4-triazolo[4,3-a]pyrimidine-3-carboxylic acid

Description:

7-Methyl-1,2,4-triazolo[4,3-a]pyrimidine-3-carboxylic acid is a heterocyclic compound characterized by its unique triazole and pyrimidine ring structures. This compound features a methyl group at the 7-position of the triazole ring and a carboxylic acid functional group at the 3-position of the pyrimidine moiety, contributing to its potential biological activity. The presence of these functional groups suggests that it may exhibit properties such as acidity and the ability to participate in hydrogen bonding, which can influence its solubility and reactivity. The compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its molecular structure allows for interactions with various biological targets, making it a candidate for further research in pharmacology. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings.

Formula: C₇H₆N₄O₂

InChI: InChI=1S/C7H6N4O2/c1-4-2-3-11-5(6(12)13)9-10-7(11)8-4/h2-3H,1H3,(H,12,13)

InChI key: InChIKey=OKHCRVRHLQRYGZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N2C(=NN1)N=C(C)C=C2

Synonyms:

• 7-Methyl-1,2,4-triazolo[4,3-a]pyrimidine-3-carboxylic acid
• 1,2,4-Triazolo[4,3-a]pyrimidine-3-carboxylic acid, 7-methyl-

7-methyl[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxylic acid

CAS: 1256643-42-1

Formula: C₇H₆N₄O₂

Purity: 95.0%

Color and Shape: Solid, Light yellow powder

Molecular weight: 178.151

Ref: 10-F312810