CAS 1256643-48-7

rel-(3aR,6aS)-Tetrahydro-2-methylpyrrolo[3,4-c]pyrrole-1,3(2H,3aH)-dione

Description:

Rel-(3aR,6aS)-Tetrahydro-2-methylpyrrolo[3,4-c]pyrrole-1,3(2H,3aH)-dione is a chemical compound characterized by its unique bicyclic structure, which includes a pyrrole ring fused to a tetrahydro-pyrrole moiety. This compound features a methyl group at the 2-position of the pyrrole ring and two carbonyl groups, contributing to its reactivity and potential biological activity. The stereochemistry indicated by the rel-(3aR,6aS) notation suggests specific spatial arrangements of the atoms, which can influence the compound's interactions with biological targets. It is likely to exhibit properties typical of nitrogen-containing heterocycles, such as solubility in organic solvents and potential for hydrogen bonding. The compound may also be of interest in medicinal chemistry due to its structural features, which could lead to the development of novel pharmaceuticals. However, detailed studies on its pharmacological properties, toxicity, and synthesis would be necessary to fully understand its applications and behavior in various chemical environments.

Formula: C₇H₁₀N₂O₂

InChI: InChI=1/C7H10N2O2/c1-9-6(10)4-2-8-3-5(4)7(9)11/h4-5,8H,2-3H2,1H3/t4-,5+

InChI key: InChIKey=QORSINSMFQKJDX-SYDPRGILNA-N

SMILES: O=C1[C@@]2([C@](C(=O)N1C)(CNC2)[H])[H]

Synonyms:

• rel-(3aR,6aS)-Tetrahydro-2-methylpyrrolo[3,4-c]pyrrole-1,3(2H,3aH)-dione
• (3AS,6aR)-2-methyl-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-c]pyrrole-1,3-dione
• (3AR,6aS)-2-methyl-octahydropyrrolo[3,4-c]pyrrole-1,3-dione
• (3AR*,6aS*)-2-methyltetrahydropyrrolo[3,4-c]pyrrole-1,3(2H,3aH)-dione
• Pyrrolo[3,4-c]pyrrole-1,3(2H,3aH)-dione, tetrahydro-2-methyl-, (3aR,6aS)-rel-