CAS 1256643-55-6: 5,7-Dimethyl-2,1,3-benzoxadiazole-4-sulfonyl chloride

Description:5,7-Dimethyl-2,1,3-benzoxadiazole-4-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a benzoxadiazole core, which contributes to its potential applications in various fields, including pharmaceuticals and materials science. The presence of methyl groups at the 5 and 7 positions of the benzoxadiazole ring enhances its solubility and may influence its electronic properties. As a sulfonyl chloride, it can participate in nucleophilic substitution reactions, making it useful for synthesizing other chemical entities. The compound is typically handled with care due to its reactive nature, particularly in the presence of moisture, which can lead to hydrolysis. Its unique structure and reactivity profile make it a valuable intermediate in organic synthesis, particularly in the development of dyes, agrochemicals, and biologically active molecules. Safety precautions should be observed when working with this compound due to its potential irritant properties.

Formula:C₈H₇ClN₂O₃S

InChI:InChI=1S/C8H7ClN2O3S/c1-4-3-5(2)8(15(9,12)13)7-6(4)10-14-11-7/h3H,1-2H3

InChI key:InChIKey=KFIKFRDBDZKOMA-UHFFFAOYSA-N

SMILES:O=S(=O)(Cl)C=1C2=NON=C2C(=CC1C)C

Synonyms:
2,1,3-Benzoxadiazole-4-sulfonyl chloride, 5,7-dimethyl-
5,7-Dimethyl-2,1,3-benzoxadiazole-4-sulfonyl chloride

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2,1,3-Benzoxadiazole-4-sulfonyl chloride, 5,7-dimethyl- REF: IN-DA000OAVCAS: 1256643-55-6	- - -	To inquire	Wed 26 Mar 25
5,7-dimethyl-2,1,3-benzoxadiazole-4-sulfonyl chloride REF: 10-F312481CAS: 1256643-55-6	95.0%	To inquire	Mon 07 Apr 25
8-isoMisoprostol REF: 3D-FM177122CAS: 1256643-55-6	Min. 95%	- - -	Discontinued product