CAS 1256643-58-9: 3-Methyl-3H-1,2,3-triazolo[4,5-b]pyridine-6-carboxylic acid
Description:3-Methyl-3H-1,2,3-triazolo[4,5-b]pyridine-6-carboxylic acid is a heterocyclic compound characterized by its unique triazole and pyridine ring structures. This compound features a methyl group at the 3-position of the triazole ring and a carboxylic acid functional group at the 6-position of the pyridine ring, contributing to its potential as a bioactive molecule. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as triazoles are known for their diverse biological activities. Additionally, the presence of both nitrogen and carboxylic acid functionalities may enhance its reactivity and interaction with biological targets. Overall, 3-Methyl-3H-1,2,3-triazolo[4,5-b]pyridine-6-carboxylic acid represents a valuable compound for further research in various chemical and biological fields.
Formula:C7H6N4O2
InChI:InChI=1S/C7H6N4O2/c1-11-6-5(9-10-11)2-4(3-8-6)7(12)13/h2-3H,1H3,(H,12,13)
InChI key:InChIKey=QDFVDLJZCYHXHE-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=NC2=C(N=NN2C)C1
- Synonyms:
- 3H-1,2,3-Triazolo[4,5-b]pyridine-6-carboxylic acid, 3-methyl-
- 3-Methyl-3H-1,2,3-triazolo[4,5-b]pyridine-6-carboxylic acid

3-methyl-3H-[1,2,3]triazolo[4,5-b]pyridine-6-carboxylic acid
Ref: IN-DA009DX5
1g | 293.00 € | ||
5g | To inquire | ||
100mg | 126.00 € | ||
250mg | 166.00 € | ||
500mg | 196.00 € |

3-Methyl-3H-[1,2,3]triazolo[4,5-b]pyridine-6-carboxylic acid
Ref: 10-F767764
1g | To inquire | ||
5g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |

3-Methyl-3H-[1,2,3]triazolo[4,5-b]pyridine-6-carboxylic acid
Ref: 3D-GAC64358
250mg | 413.00 € | ||
2500mg | 1,214.00 € |