
CAS 125678-52-6
:2-Propyn-1-amine, N,N-diethyl-, radical ion(1+)
Description:
2-Propyn-1-amine, N,N-diethyl-, radical ion(1+) is a chemical compound characterized by its structure, which includes a propynyl group attached to an amine functional group with two ethyl substituents. As a radical cation, it possesses an unpaired electron, which contributes to its reactivity and stability under certain conditions. This compound is likely to exhibit properties typical of both amines and radical species, such as nucleophilicity and the ability to participate in electron transfer reactions. The presence of the ethyl groups may influence its steric hindrance and solubility in various solvents. Additionally, radical ions are often involved in various chemical processes, including polymerization and redox reactions. The stability of this radical ion can be affected by factors such as temperature and the presence of other reactive species. Overall, 2-Propyn-1-amine, N,N-diethyl-, radical ion(1+) represents a unique class of compounds with potential applications in organic synthesis and materials science.
Formula:C7H13N
InChI:InChI=1S/C7H13N/c1-4-7-8(5-2)6-3/h1H,5-7H2,2-3H3
InChI key:InChIKey=JZJXKEWVUBVOEH-UHFFFAOYSA-N
SMILES:N(CC#C)(CC)CC
Synonyms:- 2-Propyn-1-amine, N,N-diethyl-, radical ion(1+)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

