CymitQuimica logo

CAS 1256781-61-9

:

2,4-Dibromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol

Description:
2,4-Dibromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol is an organic compound characterized by its complex structure, which includes a phenolic group and a boron-containing moiety. The presence of bromine atoms at the 2 and 4 positions of the phenol ring enhances its reactivity and potential applications in various chemical reactions, particularly in cross-coupling reactions such as Suzuki coupling. The tetramethyl-1,3,2-dioxaborolane group contributes to its stability and solubility in organic solvents, making it useful in synthetic organic chemistry. This compound may exhibit properties such as moderate to high polarity due to the hydroxyl group, and it may also show biological activity, although specific biological properties would require further investigation. Its unique structure allows for potential applications in materials science, pharmaceuticals, and agrochemicals, particularly in the development of new compounds with desired functionalities. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.
Formula:C12H15BBr2O3
InChI:InChI=1S/C12H15BBr2O3/c1-11(2)12(3,4)18-13(17-11)9-7(14)5-6-8(16)10(9)15/h5-6,16H,1-4H3
InChI key:InChIKey=LXTGMRKXRZPUKV-UHFFFAOYSA-N
SMILES:BrC1=C(B2OC(C)(C)C(C)(C)O2)C(Br)=CC=C1O
Synonyms:
  • 2,4-Dibromo-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenol
  • 2,4-Dibromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol
  • Phenol, 2,4-dibromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.