CymitQuimica logo

CAS 1256781-66-4

:

2-[2-Bromo-5-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-[2-Bromo-5-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a brominated aromatic substituent. The presence of the trifluoromethoxy group enhances its electronic properties, making it potentially useful in various chemical applications, including medicinal chemistry and materials science. The compound's boron atom is typically involved in coordination chemistry, which can facilitate reactions such as Suzuki coupling, a common method for forming carbon-carbon bonds. Its stability and reactivity can be influenced by the steric hindrance provided by the tetramethyl groups, which may affect its solubility and interaction with other reagents. Additionally, the bromine atom can serve as a leaving group in nucleophilic substitution reactions. Overall, this compound exemplifies the intersection of organoboron chemistry and functionalized aromatic systems, making it a subject of interest for further research and application in synthetic organic chemistry.
Formula:C13H15BBrF3O3
InChI:InChI=1S/C13H15BBrF3O3/c1-11(2)12(3,4)21-14(20-11)9-7-8(5-6-10(9)15)19-13(16,17)18/h5-7H,1-4H3
InChI key:InChIKey=MXRGQKOYIDQMFT-UHFFFAOYSA-N
SMILES:BrC=1C(=CC(OC(F)(F)F)=CC1)B2OC(C)(C)C(C)(C)O2
Synonyms:
  • 2-[2-Bromo-5-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
  • 1,3,2-Dioxaborolane, 2-[2-bromo-5-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.