CAS 1256784-27-6

4-Chloro-6,7-dihydro-6-methyl-5H-cyclopentapyrimidine

Description:

4-Chloro-6,7-dihydro-6-methyl-5H-cyclopentapyrimidine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyrimidine and a cyclopentane moiety. The presence of a chlorine atom at the 4-position and a methyl group at the 6-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyrimidine ring, which is a common scaffold in many biologically active compounds. The compound's properties, such as melting point, boiling point, and spectral characteristics, would be influenced by the substituents on the ring and the overall molecular conformation. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it a versatile building block in organic synthesis.

Formula: C₈H₉ClN₂

InChI: InChI=1S/C8H9ClN2/c1-5-2-6-7(3-5)10-4-11-8(6)9/h4-5H,2-3H2,1H3

InChI key: InChIKey=TXQJBTKTHRIGNM-UHFFFAOYSA-N

SMILES: ClC1=C2C(CC(C)C2)=NC=N1

Synonyms:

• 4-Chloro-6,7-dihydro-6-methyl-5H-cyclopentapyrimidine
• 5H-Cyclopentapyrimidine, 4-chloro-6,7-dihydro-6-methyl-