CAS 1256784-28-7

4-Chloro-6-cyclopropyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine

Description:

4-Chloro-6-cyclopropyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. The presence of a chlorine atom at the 4-position and a cyclopropyl group at the 6-position contributes to its unique chemical properties and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound may also display various functional properties, such as fluorescence or reactivity with nucleophiles, due to the electron-withdrawing nature of the chlorine substituent. As with many heterocycles, its synthesis and characterization involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its identity and purity. Overall, 4-Chloro-6-cyclopropyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine represents a valuable scaffold for further research in pharmaceutical applications.

Formula: C₁₀H₁₂ClN₃

InChI: InChI=1S/C10H12ClN3/c11-10-8-5-14(7-1-2-7)4-3-9(8)12-6-13-10/h6-7H,1-5H2

InChI key: InChIKey=MNIUVQUFLIAVQT-UHFFFAOYSA-N

SMILES: ClC1=C2C(CCN(C2)C3CC3)=NC=N1

Synonyms:

• 4-Chloro-6-cyclopropyl-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine
• Pyrido[4,3-d]pyrimidine, 4-chloro-6-cyclopropyl-5,6,7,8-tetrahydro-