CymitQuimica logo

CAS 1256785-11-1

:

6-Chloro-5-fluoro-1H-pyrazolo[3,4-b]pyridine

Description:
6-Chloro-5-fluoro-1H-pyrazolo[3,4-b]pyridine is a heterocyclic compound characterized by its fused pyrazole and pyridine rings, which contribute to its unique chemical properties. The presence of chlorine and fluorine substituents enhances its reactivity and potential biological activity. This compound typically exhibits moderate to high lipophilicity due to the aromatic nature of its structure, which can influence its solubility and permeability in biological systems. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, owing to the electron-withdrawing effects of the halogen substituents. Additionally, compounds of this class are often investigated for their pharmacological properties, including potential applications in medicinal chemistry as they may exhibit activity against specific biological targets. The structural features of 6-Chloro-5-fluoro-1H-pyrazolo[3,4-b]pyridine make it a subject of interest in drug discovery and development, particularly in the search for new therapeutic agents.
Formula:C6H3ClFN3
InChI:InChI=1S/C6H3ClFN3/c7-5-4(8)1-3-2-9-11-6(3)10-5/h1-2H,(H,9,10,11)
InChI key:InChIKey=IOSXYFRHMYJTGS-UHFFFAOYSA-N
SMILES:FC=1C=C2C(=NC1Cl)NN=C2
Synonyms:
  • 1H-Pyrazolo[3,4-b]pyridine, 6-chloro-5-fluoro-
  • 6-Chloro-5-fluoro-1H-pyrazolo[3,4-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.