CAS 1256785-41-7

3-Amino-5-chloro-4-pyridinecarboxylic acid

Description:

3-Amino-5-chloro-4-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an amino group (-NH2) and a carboxylic acid group (-COOH) contributes to its functionality, making it a potential candidate for various chemical reactions and applications in pharmaceuticals and agrochemicals. The chlorine substituent at the 5-position of the pyridine ring introduces additional reactivity and can influence the compound's biological activity. This compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the carboxylic acid group. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on its purity and the conditions under which it is synthesized or stored. Overall, 3-Amino-5-chloro-4-pyridinecarboxylic acid is a versatile compound with significant implications in various fields of research.

Formula: C₆H₅ClN₂O₂

InChI: InChI=1S/C6H5ClN2O2/c7-3-1-9-2-4(8)5(3)6(10)11/h1-2H,8H2,(H,10,11)

InChI key: InChIKey=JPKMLYFUVQKDEZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(Cl)=CN=CC1N

Synonyms:

• 3-Amino-5-chloro-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 3-amino-5-chloro-