CymitQuimica logo

CAS 1256786-28-3

:

Methyl 6-(methylamino)-2-pyridinecarboxylate

Description:
Methyl 6-(methylamino)-2-pyridinecarboxylate is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methylamino group, which contributes to its basicity and potential reactivity. The presence of the carboxylate functional group indicates that it can participate in various chemical reactions, such as esterification or amidation. Methyl 6-(methylamino)-2-pyridinecarboxylate is likely to be a polar molecule due to the electronegative nitrogen and oxygen atoms, which can influence its solubility in polar solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if ingested or inhaled.
Formula:C8H10N2O2
InChI:InChI=1S/C8H10N2O2/c1-9-7-5-3-4-6(10-7)8(11)12-2/h3-5H,1-2H3,(H,9,10)
InChI key:InChIKey=PBSPOYWSYIHTOO-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N=C(NC)C=CC1
Synonyms:
  • 2-Pyridinecarboxylic acid, 6-(methylamino)-, methyl ester
  • Methyl 6-(methylamino)-2-pyridinecarboxylate
  • Methyl 6-(methylamino)picolinate
  • 6-Methylaminopyridine-2-carboxylic acid methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.